C18H37N5S — CID 109486618
N,2-diethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide (PubChem CID 109486618) has the molecular formula C18H37N5S and a molecular weight of 355.60 g/mol. Its IUPAC name is N,2-diethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486618 |
| Molecular Formula | C18H37N5S |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | N,2-diethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(C)CC1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C18H37N5S/c1-5-17-15-23(11-12-24-17)18(19-6-2)20-13-16(3)14-22-9-7-21(4)8-10-22/h16-17H,5-15H2,1-4H3,(H,19,20) |
| InChIKey | KQCIXEJNIQHOCF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|