C17H35N5O — CID 111549700
(3R)-N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-hydroxypyrrolidine-1-carboximidamide (PubChem CID 111549700) has the molecular formula C17H35N5O and a molecular weight of 325.50 g/mol. Its IUPAC name is (3R)-N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111549700 |
| Molecular Formula | C17H35N5O |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (3R)-N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(CC)CC1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C17H35N5O/c1-4-18-17(22-7-6-16(23)14-22)19-12-15(3)13-21-10-8-20(5-2)9-11-21/h15-16,23H,4-14H2,1-3H3,(H,18,19)/t15?,16-/m1/s1 |
| InChIKey | ZMSCHUPAJPAMMW-OEMAIJDKSA-N |
| XLogP | 0.29 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|