C17H36IN3OS — CID 109487023
N,2-diethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109487023) has the molecular formula C17H36IN3OS and a molecular weight of 457.47 g/mol. Its IUPAC name is N,2-diethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N,2-diethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109487023 |
| Molecular Formula | C17H36IN3OS |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N,2-diethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C17H35N3OS.HI/c1-5-16-13-20(8-10-22-16)17(18-6-2)19-12-15(7-9-21)11-14(3)4;/h14-16,21H,5-13H2,1-4H3,(H,18,19);1H |
| InChIKey | VMMRUTVELJDPDO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|