C19H29N7O2 — CID 111279145
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-nitroanilino)ethyl]guanidine (PubChem CID 111279145) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-nitroanilino)ethyl]guanidine.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111279145 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(4-nitroanilino)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H29N7O2/c1-4-20-19(22-10-5-13-25-16(3)14-15(2)24-25)23-12-11-21-17-6-8-18(9-7-17)26(27)28/h6-9,14,21H,4-5,10-13H2,1-3H3,(H2,20,22,23) |
| InChIKey | OYUROEYUTXQZHU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|