C16H25F3N4O2S — CID 109471177
1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471177) has the molecular formula C16H25F3N4O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471177 |
| Molecular Formula | C16H25F3N4O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCNS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H25F3N4O2S/c1-4-20-15(21-8-7-16(17,18)19)22-9-10-23-26(24,25)14-11-12(2)5-6-13(14)3/h5-6,11,23H,4,7-10H2,1-3H3,(H2,20,21,22) |
| InChIKey | YBYGKIPKIDBAKD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|