C20H28FIN4O2S — CID 111230966
1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111230966) has the molecular formula C20H28FIN4O2S and a molecular weight of 534.44 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111230966 |
| Molecular Formula | C20H28FIN4O2S |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCCNS(=O)(=O)c1cc(C)ccc1C.I |
| InChI | InChI=1S/C20H27FN4O2S.HI/c1-4-22-20(24-14-17-7-9-18(21)10-8-17)23-11-12-25-28(26,27)19-13-15(2)5-6-16(19)3;/h5-10,13,25H,4,11-12,14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | PYIILYAJIQKJMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|