C15H24F3IN4O2S — CID 109473154
1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473154) has the molecular formula C15H24F3IN4O2S and a molecular weight of 508.35 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473154 |
| Molecular Formula | C15H24F3IN4O2S |
| Molecular Weight | 508.35 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCNS(=O)(=O)c1ccc(C)cc1.I |
| InChI | InChI=1S/C15H23F3N4O2S.HI/c1-3-19-14(20-9-8-15(16,17)18)21-10-11-22-25(23,24)13-6-4-12(2)5-7-13;/h4-7,22H,3,8-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | GLDAGIQCMZPXMU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|