C18H26IN5O2S — CID 110967983
1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110967983) has the molecular formula C18H26IN5O2S and a molecular weight of 503.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110967983 |
| Molecular Formula | C18H26IN5O2S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCNS(=O)(=O)c1ccc(C)cc1.I |
| InChI | InChI=1S/C18H25N5O2S.HI/c1-3-19-18(22-14-16-6-4-5-11-20-16)21-12-13-23-26(24,25)17-9-7-15(2)8-10-17;/h4-11,23H,3,12-14H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | LYEXCSUUPUKINA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|