C20H27F2IN4O3S — CID 111865091
2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111865091) has the molecular formula C20H27F2IN4O3S and a molecular weight of 568.43 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111865091 |
| Molecular Formula | C20H27F2IN4O3S |
| Molecular Weight | 568.43 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)NCCNS(=O)(=O)c1ccc(C)cc1.I |
| InChI | InChI=1S/C20H26F2N4O3S.HI/c1-3-23-20(25-14-16-6-4-5-7-18(16)29-19(21)22)24-12-13-26-30(27,28)17-10-8-15(2)9-11-17;/h4-11,19,26H,3,12-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | LDQGNDHGVKOQQE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|