C21H41IN6 — CID 111280756
1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111280756) has the molecular formula C21H41IN6 and a molecular weight of 504.51 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111280756 |
| Molecular Formula | C21H41IN6 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCN1CC(C)CC(C)C1)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C21H40N6.HI/c1-17-13-18(2)16-26(15-17)11-7-6-9-23-21(22-5)24-10-8-12-27-20(4)14-19(3)25-27;/h14,17-18H,6-13,15-16H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | XVSFLSVTWRQQFI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|