C13H21N3OS — CID 122098466
2-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 122098466) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 122098466 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\C[C@H]1CCC[C@@H]1O)NCCc1cccs1 |
| InChI | InChI=1S/C13H21N3OS/c14-13(15-7-6-11-4-2-8-18-11)16-9-10-3-1-5-12(10)17/h2,4,8,10,12,17H,1,3,5-7,9H2,(H3,14,15,16)/t10-,12+/m1/s1 |
| InChIKey | BKFXHAPYTHWXDT-PWSUYJOCSA-N |
| XLogP | 1.36 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|