C13H22IN3OS — CID 119119724
2-(oxan-3-ylmethyl)-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 119119724) has the molecular formula C13H22IN3OS and a molecular weight of 395.31 g/mol. Its IUPAC name is 2-(oxan-3-ylmethyl)-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(oxan-3-ylmethyl)-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119119724 |
| Molecular Formula | C13H22IN3OS |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-(oxan-3-ylmethyl)-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCCOC1)NCCc1cccs1 |
| InChI | InChI=1S/C13H21N3OS.HI/c14-13(15-6-5-12-4-2-8-18-12)16-9-11-3-1-7-17-10-11;/h2,4,8,11H,1,3,5-7,9-10H2,(H3,14,15,16);1H |
| InChIKey | NBTFRRFHNXTQJS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|