C19H29Cl2IN4O — CID 111306314
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine;hydroiodide (PubChem CID 111306314) has the molecular formula C19H29Cl2IN4O and a molecular weight of 527.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306314 |
| Molecular Formula | C19H29Cl2IN4O |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine;hydroiodide |
| SMILES | CCC(CCN/C(=N\C)N(C)Cc1ccc(Cl)c(Cl)c1)N1CCCC1=O.I |
| InChI | InChI=1S/C19H28Cl2N4O.HI/c1-4-15(25-11-5-6-18(25)26)9-10-23-19(22-2)24(3)13-14-7-8-16(20)17(21)12-14;/h7-8,12,15H,4-6,9-11,13H2,1-3H3,(H,22,23);1H |
| InChIKey | TVXJOQRWKITJGO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|