C18H26F4N4 — CID 111285083
3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111285083) has the molecular formula C18H26F4N4 and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111285083 |
| Molecular Formula | C18H26F4N4 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H26F4N4/c1-3-23-17(25(2)11-14-5-4-6-16(19)9-14)24-10-15-7-8-26(12-15)13-18(20,21)22/h4-6,9,15H,3,7-8,10-13H2,1-2H3,(H,23,24) |
| InChIKey | XWHIGXCCVLMCBY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|