C20H24F3IN4O — CID 111300042
3-[[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111300042) has the molecular formula C20H24F3IN4O and a molecular weight of 520.34 g/mol. Its IUPAC name is 3-[[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111300042 |
| Molecular Formula | C20H24F3IN4O |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 3-[[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(C(=O)NC)c1)N(C)Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H23F3N4O.HI/c1-24-18(28)16-6-4-5-15(11-16)12-26-19(25-2)27(3)13-14-7-9-17(10-8-14)20(21,22)23;/h4-11H,12-13H2,1-3H3,(H,24,28)(H,25,26);1H |
| InChIKey | XNGQUVWTNDZXQG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|