C20H24F2N4O2 — CID 111288443
3-[[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide (PubChem CID 111288443) has the molecular formula C20H24F2N4O2 and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-[[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111288443 |
| Molecular Formula | C20H24F2N4O2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NC)c1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H24F2N4O2/c1-23-18(27)16-6-4-5-15(11-16)12-25-20(24-2)26(3)13-14-7-9-17(10-8-14)28-19(21)22/h4-11,19H,12-13H2,1-3H3,(H,23,27)(H,24,25) |
| InChIKey | XNBYQTUCFPSAFZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|