C18H25F3IN5O2S — CID 109456647
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide (PubChem CID 109456647) has the molecular formula C18H25F3IN5O2S and a molecular weight of 559.40 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109456647 |
| Molecular Formula | C18H25F3IN5O2S |
| Molecular Weight | 559.40 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc(C(F)(F)F)cn1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C18H24F3N5O2S.HI/c1-12(27-4)16-25-14(11-29-16)10-26(3)17(22-2)23-7-8-28-15-6-5-13(9-24-15)18(19,20)21;/h5-6,9,11-12H,7-8,10H2,1-4H3,(H,22,23);1H |
| InChIKey | CJMGVUSZDOCJSJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|