C16H19ClF3N5OS — CID 109420764
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109420764) has the molecular formula C16H19ClF3N5OS and a molecular weight of 421.88 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109420764 |
| Molecular Formula | C16H19ClF3N5OS |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCOc1ncc(C(F)(F)F)cc1Cl)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C16H19ClF3N5OS/c1-10-24-12(9-27-10)8-25(3)15(21-2)22-4-5-26-14-13(17)6-11(7-23-14)16(18,19)20/h6-7,9H,4-5,8H2,1-3H3,(H,21,22) |
| InChIKey | NVXVLMZGFGGBNE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|