C18H22F3N5OS — CID 111299993
N-[2-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111299993) has the molecular formula C18H22F3N5OS and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[2-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111299993 |
| Molecular Formula | C18H22F3N5OS |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[2-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | C/N=C(\NCCNC(=O)c1scnc1C)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H22F3N5OS/c1-12-15(28-11-25-12)16(27)23-8-9-24-17(22-2)26(3)10-13-4-6-14(7-5-13)18(19,20)21/h4-7,11H,8-10H2,1-3H3,(H,22,24)(H,23,27) |
| InChIKey | SXSKRULHRUJTPJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|