C19H25N5O — CID 110951922
3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 110951922) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 110951922 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1cccc(C)n1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H25N5O/c1-15-8-7-11-17(22-15)23-18(25)12-13-21-19(20-2)24(3)14-16-9-5-4-6-10-16/h4-11H,12-14H2,1-3H3,(H,20,21)(H,22,23,25) |
| InChIKey | OAJFSJSRBOOFCU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|