C17H34N4O2S — CID 109483119
3-ethyl-1-hept-6-enyl-1-methyl-2-[(1-methylsulfonylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 109483119) has the molecular formula C17H34N4O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[(1-methylsulfonylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(1-methylsulfonylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109483119 |
| Molecular Formula | C17H34N4O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(1-methylsulfonylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N/CC1CCN(S(C)(=O)=O)C1)NCC |
| InChI | InChI=1S/C17H34N4O2S/c1-5-7-8-9-10-12-20(3)17(18-6-2)19-14-16-11-13-21(15-16)24(4,22)23/h5,16H,1,6-15H2,2-4H3,(H,18,19) |
| InChIKey | CTPISWJVIZLRMY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|