C19H36N4O — CID 109484075
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine (PubChem CID 109484075) has the molecular formula C19H36N4O and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
|---|---|
| PubChem CID | 109484075 |
| Molecular Formula | C19H36N4O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N/CC1CN2CCCC2CO1)NCC |
| InChI | InChI=1S/C19H36N4O/c1-4-6-7-8-9-12-22(3)19(20-5-2)21-14-18-15-23-13-10-11-17(23)16-24-18/h4,17-18H,1,5-16H2,2-3H3,(H,20,21) |
| InChIKey | DSRUFHBXWQILNC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|