C15H25F3IN5 — CID 109498355
3-ethyl-1-methyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109498355) has the molecular formula C15H25F3IN5 and a molecular weight of 459.30 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109498355 |
| Molecular Formula | C15H25F3IN5 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 3-ethyl-1-methyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/Cc1cn(C)nc1C(F)(F)F)NCC.I |
| InChI | InChI=1S/C15H24F3N5.HI/c1-5-7-8-9-22(3)14(19-6-2)20-10-12-11-23(4)21-13(12)15(16,17)18;/h5,11H,1,6-10H2,2-4H3,(H,19,20);1H |
| InChIKey | UFTUGRSQPWKFEK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|