C12H17F6N5 — CID 109473767
1-ethyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473767) has the molecular formula C12H17F6N5 and a molecular weight of 345.29 g/mol. Its IUPAC name is 1-ethyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473767 |
| Molecular Formula | C12H17F6N5 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-ethyl-2-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cn(C)nc1C(F)(F)F)NCCC(F)(F)F |
| InChI | InChI=1S/C12H17F6N5/c1-3-19-10(20-5-4-11(13,14)15)21-6-8-7-23(2)22-9(8)12(16,17)18/h7H,3-6H2,1-2H3,(H2,19,20,21) |
| InChIKey | URWIKXUBHIZZTR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|