C17H28N6O — CID 111835439
1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine (PubChem CID 111835439) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine.
| Compound Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 111835439 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine |
| SMILES | C/N=C(/NCc1nc(-c2ccco2)n[nH]1)NC(C)CCCC(C)C |
| InChI | InChI=1S/C17H28N6O/c1-12(2)7-5-8-13(3)20-17(18-4)19-11-15-21-16(23-22-15)14-9-6-10-24-14/h6,9-10,12-13H,5,7-8,11H2,1-4H3,(H2,18,19,20)(H,21,22,23) |
| InChIKey | PYLZBJKREUNBNF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|