C21H28IN7O2 — CID 111839310
1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111839310) has the molecular formula C21H28IN7O2 and a molecular weight of 537.41 g/mol. Its IUPAC name is 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111839310 |
| Molecular Formula | C21H28IN7O2 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(-c2ccco2)n[nH]1)NCc1ccccc1CN1CCOCC1.I |
| InChI | InChI=1S/C21H27N7O2.HI/c1-22-21(24-14-19-25-20(27-26-19)18-7-4-10-30-18)23-13-16-5-2-3-6-17(16)15-28-8-11-29-12-9-28;/h2-7,10H,8-9,11-15H2,1H3,(H2,22,23,24)(H,25,26,27);1H |
| InChIKey | WJJPFIOUDCOMCR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|