C16H24N6O — CID 109497788
3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109497788) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is 3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109497788 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C16H24N6O/c1-4-5-6-11-22(3)16(17-2)18-10-9-14-19-15(21-20-14)13-8-7-12-23-13/h4,7-8,12H,1,5-6,9-11H2,2-3H3,(H,17,18)(H,19,20,21) |
| InChIKey | NZUJJSQPCBEXOS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|