C16H23N7O2 — CID 111546987
4-acetyl-N-ethyl-N'-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboximidamide (PubChem CID 111546987) has the molecular formula C16H23N7O2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111546987 |
| Molecular Formula | C16H23N7O2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccco2)n[nH]1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H23N7O2/c1-3-17-16(23-8-6-22(7-9-23)12(2)24)18-11-14-19-15(21-20-14)13-5-4-10-25-13/h4-5,10H,3,6-9,11H2,1-2H3,(H,17,18)(H,19,20,21) |
| InChIKey | CITKEZSKTCJJDS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|