C14H15BrN2OS2 — CID 3771523
1-(4-bromophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 3771523) has the molecular formula C14H15BrN2OS2 and a molecular weight of 371.33 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3771523 |
| Molecular Formula | C14H15BrN2OS2 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 1-(4-bromophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | S=C(NCCSCc1ccco1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H15BrN2OS2/c15-11-3-5-12(6-4-11)17-14(19)16-7-9-20-10-13-2-1-8-18-13/h1-6,8H,7,9-10H2,(H2,16,17,19) |
| InChIKey | GAZFFIWSLXUPRB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|