C17H22N2OS2 — CID 2447577
1-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 2447577) has the molecular formula C17H22N2OS2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 2447577 |
| Molecular Formula | C17H22N2OS2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 1-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)NCCSCc1ccco1 |
| InChI | InChI=1S/C17H22N2OS2/c1-13(2)15-7-3-4-8-16(15)19-17(21)18-9-11-22-12-14-6-5-10-20-14/h3-8,10,13H,9,11-12H2,1-2H3,(H2,18,19,21) |
| InChIKey | IGGVCJCDAKXWHC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|