C14H11BrClFN2S — CID 46924144
1-(2-bromo-4-fluorophenyl)-3-(4-chloro-2-methylphenyl)thiourea (PubChem CID 46924144) has the molecular formula C14H11BrClFN2S and a molecular weight of 373.68 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3-(4-chloro-2-methylphenyl)thiourea.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3-(4-chloro-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 46924144 |
| Molecular Formula | C14H11BrClFN2S |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3-(4-chloro-2-methylphenyl)thiourea |
| SMILES | Cc1cc(Cl)ccc1NC(=S)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C14H11BrClFN2S/c1-8-6-9(16)2-4-12(8)18-14(20)19-13-5-3-10(17)7-11(13)15/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | KAPFJGFYGPTGLL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|