C13H13ClN3S+ — CID 4738940
1-(4-chloro-2-methylphenyl)-3-pyridin-1-ium-2-ylthiourea (PubChem CID 4738940) has the molecular formula C13H13ClN3S+ and a molecular weight of 278.79 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-pyridin-1-ium-2-ylthiourea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-pyridin-1-ium-2-ylthiourea |
|---|---|
| PubChem CID | 4738940 |
| Molecular Formula | C13H13ClN3S+ |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-pyridin-1-ium-2-ylthiourea |
| SMILES | Cc1cc(Cl)ccc1NC(=S)Nc1cccc[nH+]1 |
| InChI | InChI=1S/C13H12ClN3S/c1-9-8-10(14)5-6-11(9)16-13(18)17-12-4-2-3-7-15-12/h2-8H,1H3,(H2,15,16,17,18)/p+1 |
| InChIKey | BMYHYBZRMXACAK-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 38.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|