C21H26N2OS2 — CID 100693726
1-[3-[(2-methylphenyl)methylsulfanyl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea (PubChem CID 100693726) has the molecular formula C21H26N2OS2 and a molecular weight of 386.59 g/mol. Its IUPAC name is 1-[3-[(2-methylphenyl)methylsulfanyl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[3-[(2-methylphenyl)methylsulfanyl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100693726 |
| Molecular Formula | C21H26N2OS2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-[3-[(2-methylphenyl)methylsulfanyl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cccc(NC(=S)NCCCSCc2ccccc2C)c1 |
| InChI | InChI=1S/C21H26N2OS2/c1-3-13-24-20-11-6-10-19(15-20)23-21(25)22-12-7-14-26-16-18-9-5-4-8-17(18)2/h3-6,8-11,15H,1,7,12-14,16H2,2H3,(H2,22,23,25) |
| InChIKey | OMIQXLQCUQAJBQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|