C19H20ClFN2OS2 — CID 100606046
1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(3-prop-2-enoxyphenyl)thiourea (PubChem CID 100606046) has the molecular formula C19H20ClFN2OS2 and a molecular weight of 410.97 g/mol. Its IUPAC name is 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(3-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(3-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100606046 |
| Molecular Formula | C19H20ClFN2OS2 |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(3-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cccc(NC(=S)NCCSCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C19H20ClFN2OS2/c1-2-10-24-15-6-3-5-14(12-15)23-19(25)22-9-11-26-13-16-17(20)7-4-8-18(16)21/h2-8,12H,1,9-11,13H2,(H2,22,23,25) |
| InChIKey | DBYPLLXXEFTDGI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|