C37H48N8 — CID 59548024
1-[3-[3-[[(E)-[amino-(2,2-diphenylethylamino)methylidene]amino]methylamino]propylamino]propyl]-2-(2,2-diphenylethyl)guanidine (PubChem CID 59548024) has the molecular formula C37H48N8 and a molecular weight of 604.85 g/mol. Its IUPAC name is 1-[3-[3-[[(E)-[amino-(2,2-diphenylethylamino)methylidene]amino]methylamino]propylamino]propyl]-2-(2,2-diphenylethyl)guanidine.
| Compound Name | 1-[3-[3-[[(E)-[amino-(2,2-diphenylethylamino)methylidene]amino]methylamino]propylamino]propyl]-2-(2,2-diphenylethyl)guanidine |
|---|---|
| PubChem CID | 59548024 |
| Molecular Formula | C37H48N8 |
| Molecular Weight | 604.85 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | 1-[3-[3-[[(E)-[amino-(2,2-diphenylethylamino)methylidene]amino]methylamino]propylamino]propyl]-2-(2,2-diphenylethyl)guanidine |
| SMILES | N/C(=N\CC(c1ccccc1)c1ccccc1)NCCCNCCCNC/N=C(\N)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H48N8/c38-36(43-27-34(30-15-5-1-6-16-30)31-17-7-2-8-18-31)42-26-14-24-40-23-13-25-41-29-45-37(39)44-28-35(32-19-9-3-10-20-32)33-21-11-4-12-22-33/h1-12,15-22,34-35,40-41H,13-14,23-29H2,(H3,38,42,43)(H3,39,44,45) |
| InChIKey | NEYBCMTWXJXHJU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|