C12H17N3O2 — CID 110463054
2-amino-N-(3-formamidopropyl)-2-phenylacetamide (PubChem CID 110463054) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-amino-N-(3-formamidopropyl)-2-phenylacetamide.
| Compound Name | 2-amino-N-(3-formamidopropyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 110463054 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-amino-N-(3-formamidopropyl)-2-phenylacetamide |
| SMILES | NC(C(=O)NCCCNC=O)c1ccccc1 |
| InChI | InChI=1S/C12H17N3O2/c13-11(10-5-2-1-3-6-10)12(17)15-8-4-7-14-9-16/h1-3,5-6,9,11H,4,7-8,13H2,(H,14,16)(H,15,17) |
| InChIKey | XVPBSFODRKOTNK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|