C21H38N4O — CID 57034858
(2R)-2,5-diamino-N-[5-(3-methylbutylamino)-3-phenylpentyl]pentanamide (PubChem CID 57034858) has the molecular formula C21H38N4O and a molecular weight of 362.56 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-[5-(3-methylbutylamino)-3-phenylpentyl]pentanamide.
| Compound Name | (2R)-2,5-diamino-N-[5-(3-methylbutylamino)-3-phenylpentyl]pentanamide |
|---|---|
| PubChem CID | 57034858 |
| Molecular Formula | C21H38N4O |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | (2R)-2,5-diamino-N-[5-(3-methylbutylamino)-3-phenylpentyl]pentanamide |
| SMILES | CC(C)CCNCCC(CCNC(=O)[C@H](N)CCCN)c1ccccc1 |
| InChI | InChI=1S/C21H38N4O/c1-17(2)10-14-24-15-11-19(18-7-4-3-5-8-18)12-16-25-21(26)20(23)9-6-13-22/h3-5,7-8,17,19-20,24H,6,9-16,22-23H2,1-2H3,(H,25,26)/t19?,20-/m1/s1 |
| InChIKey | JWLZGTAQCURGSA-GFOWMXPYSA-N |
| XLogP | 2.37 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|