C19H33N2O4+ — CID 2216664
dimethyl-[(2S)-2-methyl-3-[(3,4,5-triethoxybenzoyl)amino]propyl]azanium (PubChem CID 2216664) has the molecular formula C19H33N2O4+ and a molecular weight of 353.48 g/mol. Its IUPAC name is dimethyl-[(2S)-2-methyl-3-[(3,4,5-triethoxybenzoyl)amino]propyl]azanium.
| Compound Name | dimethyl-[(2S)-2-methyl-3-[(3,4,5-triethoxybenzoyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 2216664 |
| Molecular Formula | C19H33N2O4+ |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | dimethyl-[(2S)-2-methyl-3-[(3,4,5-triethoxybenzoyl)amino]propyl]azanium |
| SMILES | CCOc1cc(C(=O)NC[C@H](C)C[NH+](C)C)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H32N2O4/c1-7-23-16-10-15(11-17(24-8-2)18(16)25-9-3)19(22)20-12-14(4)13-21(5)6/h10-11,14H,7-9,12-13H2,1-6H3,(H,20,22)/p+1/t14-/m0/s1 |
| InChIKey | JFTSDXAQGHVGIJ-AWEZNQCLSA-O |
| XLogP | 1.39 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |