C18H21ClFN3O — CID 110445798
2-chloro-N-[[4-[2-(dimethylamino)ethylamino]phenyl]methyl]-6-fluorobenzamide (PubChem CID 110445798) has the molecular formula C18H21ClFN3O and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-chloro-N-[[4-[2-(dimethylamino)ethylamino]phenyl]methyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[[4-[2-(dimethylamino)ethylamino]phenyl]methyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 110445798 |
| Molecular Formula | C18H21ClFN3O |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-chloro-N-[[4-[2-(dimethylamino)ethylamino]phenyl]methyl]-6-fluorobenzamide |
| SMILES | CN(C)CCNc1ccc(CNC(=O)c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C18H21ClFN3O/c1-23(2)11-10-21-14-8-6-13(7-9-14)12-22-18(24)17-15(19)4-3-5-16(17)20/h3-9,21H,10-12H2,1-2H3,(H,22,24) |
| InChIKey | BBRZHLBUHKBWII-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |