C15H24N2O2 — CID 110485990
2-amino-N-(3-butoxypropyl)-5-methylbenzamide (PubChem CID 110485990) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-amino-N-(3-butoxypropyl)-5-methylbenzamide.
| Compound Name | 2-amino-N-(3-butoxypropyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 110485990 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-amino-N-(3-butoxypropyl)-5-methylbenzamide |
| SMILES | CCCCOCCCNC(=O)c1cc(C)ccc1N |
| InChI | InChI=1S/C15H24N2O2/c1-3-4-9-19-10-5-8-17-15(18)13-11-12(2)6-7-14(13)16/h6-7,11H,3-5,8-10,16H2,1-2H3,(H,17,18) |
| InChIKey | DELKVSXWMCLMPX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|