C17H24N2O2 — CID 81111595
2-(3-aminoprop-1-ynyl)-N-(2-butoxyethyl)-5-methylbenzamide (PubChem CID 81111595) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-(2-butoxyethyl)-5-methylbenzamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-(2-butoxyethyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 81111595 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-(2-butoxyethyl)-5-methylbenzamide |
| SMILES | CCCCOCCNC(=O)c1cc(C)ccc1C#CCN |
| InChI | InChI=1S/C17H24N2O2/c1-3-4-11-21-12-10-19-17(20)16-13-14(2)7-8-15(16)6-5-9-18/h7-8,13H,3-4,9-12,18H2,1-2H3,(H,19,20) |
| InChIKey | GFBJMAJTMVMEPS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|