C14H16ClN3O — CID 24847582
1-methyl-3-[phenyl(pyridin-4-yl)methyl]urea;hydrochloride (PubChem CID 24847582) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 1-methyl-3-[phenyl(pyridin-4-yl)methyl]urea;hydrochloride.
| Compound Name | 1-methyl-3-[phenyl(pyridin-4-yl)methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 24847582 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-methyl-3-[phenyl(pyridin-4-yl)methyl]urea;hydrochloride |
| SMILES | CNC(=O)NC(c1ccccc1)c1ccncc1.Cl |
| InChI | InChI=1S/C14H15N3O.ClH/c1-15-14(18)17-13(11-5-3-2-4-6-11)12-7-9-16-10-8-12;/h2-10,13H,1H3,(H2,15,17,18);1H |
| InChIKey | XSUXREKKUDBLKE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |