C20H26N4O — CID 95571044
1-(1-ethylpiperidin-4-yl)-3-[(R)-phenyl(pyridin-4-yl)methyl]urea (PubChem CID 95571044) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-4-yl)-3-[(R)-phenyl(pyridin-4-yl)methyl]urea.
| Compound Name | 1-(1-ethylpiperidin-4-yl)-3-[(R)-phenyl(pyridin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 95571044 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-(1-ethylpiperidin-4-yl)-3-[(R)-phenyl(pyridin-4-yl)methyl]urea |
| SMILES | CCN1CCC(NC(=O)N[C@H](c2ccccc2)c2ccncc2)CC1 |
| InChI | InChI=1S/C20H26N4O/c1-2-24-14-10-18(11-15-24)22-20(25)23-19(16-6-4-3-5-7-16)17-8-12-21-13-9-17/h3-9,12-13,18-19H,2,10-11,14-15H2,1H3,(H2,22,23,25)/t19-/m1/s1 |
| InChIKey | ISDLYOSWEDNDIP-LJQANCHMSA-N |
| XLogP | 2.95 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |