C19H23N3O — CID 120634235
(2S,4S)-2-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 120634235) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120634235 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (2S,4S)-2-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)NC(c2ccccc2)c2ccncc2)CCN1 |
| InChI | InChI=1S/C19H23N3O/c1-14-13-17(9-12-21-14)19(23)22-18(15-5-3-2-4-6-15)16-7-10-20-11-8-16/h2-8,10-11,14,17-18,21H,9,12-13H2,1H3,(H,22,23)/t14-,17-,18?/m0/s1 |
| InChIKey | GPXUSYUJLYLMTB-LNJPMGEZSA-N |
| XLogP | 2.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |