C18H22N2O2 — CID 120631631
(2S,4S)-N-[furan-2-yl(phenyl)methyl]-2-methylpiperidine-4-carboxamide (PubChem CID 120631631) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2S,4S)-N-[furan-2-yl(phenyl)methyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[furan-2-yl(phenyl)methyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120631631 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2S,4S)-N-[furan-2-yl(phenyl)methyl]-2-methylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)NC(c2ccccc2)c2ccco2)CCN1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-12-15(9-10-19-13)18(21)20-17(16-8-5-11-22-16)14-6-3-2-4-7-14/h2-8,11,13,15,17,19H,9-10,12H2,1H3,(H,20,21)/t13-,15-,17?/m0/s1 |
| InChIKey | NVWWBMPOCZIQOK-JENVPCQVSA-N |
| XLogP | 2.87 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |