C20H25N3O — CID 120638054
(2S,4S)-2-methyl-N-[1-(4-pyridin-4-ylphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 120638054) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[1-(4-pyridin-4-ylphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-[1-(4-pyridin-4-ylphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120638054 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2S,4S)-2-methyl-N-[1-(4-pyridin-4-ylphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)[C@H]1CCN[C@@H](C)C1)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-14-13-19(9-12-22-14)20(24)23-15(2)16-3-5-17(6-4-16)18-7-10-21-11-8-18/h3-8,10-11,14-15,19,22H,9,12-13H2,1-2H3,(H,23,24)/t14-,15?,19-/m0/s1 |
| InChIKey | XTMOALLWFVWMPM-OCGXIWQUSA-N |
| XLogP | 3.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |