C19H19N3OS — CID 95318328
1-[(S)-phenyl(pyridin-4-yl)methyl]-3-(2-thiophen-2-ylethyl)urea (PubChem CID 95318328) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[(S)-phenyl(pyridin-4-yl)methyl]-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[(S)-phenyl(pyridin-4-yl)methyl]-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 95318328 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[(S)-phenyl(pyridin-4-yl)methyl]-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)N[C@@H](c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C19H19N3OS/c23-19(21-13-10-17-7-4-14-24-17)22-18(15-5-2-1-3-6-15)16-8-11-20-12-9-16/h1-9,11-12,14,18H,10,13H2,(H2,21,22,23)/t18-/m0/s1 |
| InChIKey | RMVHLMAORQHJFQ-SFHVURJKSA-N |
| XLogP | 3.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |