C24H26N4O2 — CID 78853382
2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile (PubChem CID 78853382) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile.
| Compound Name | 2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 78853382 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)N2CCN(C(=O)c3cccc4c(C)c(C)[nH]c34)CC2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-16-17(2)26-23-20(16)5-4-6-21(23)24(29)28-13-11-27(12-14-28)22(15-25)18-7-9-19(30-3)10-8-18/h4-10,22,26H,11-14H2,1-3H3 |
| InChIKey | IZQCZZKTNXTOBM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|