C17H21N3O3 — CID 118759502
methyl (2S,4R)-4-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]pyrrolidine-2-carboxylate (PubChem CID 118759502) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl (2S,4R)-4-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118759502 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | methyl (2S,4R)-4-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](NC(=O)c2cccc3c(C)c(C)[nH]c23)CN1 |
| InChI | InChI=1S/C17H21N3O3/c1-9-10(2)19-15-12(9)5-4-6-13(15)16(21)20-11-7-14(18-8-11)17(22)23-3/h4-6,11,14,18-19H,7-8H2,1-3H3,(H,20,21)/t11-,14+/m1/s1 |
| InChIKey | IMIKUJLYBBSMDT-RISCZKNCSA-N |
| XLogP | 1.42 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|