C21H22FN3O4S — CID 167935882
5-fluoro-N-[4-(methanesulfonamido)cyclohexyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 167935882) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is 5-fluoro-N-[4-(methanesulfonamido)cyclohexyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | 5-fluoro-N-[4-(methanesulfonamido)cyclohexyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 167935882 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 5-fluoro-N-[4-(methanesulfonamido)cyclohexyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | CS(=O)(=O)NC1CCC(NC(=O)c2cccc3c(=O)c4cccc(F)c4[nH]c23)CC1 |
| InChI | InChI=1S/C21H22FN3O4S/c1-30(28,29)25-13-10-8-12(9-11-13)23-21(27)16-6-2-4-14-18(16)24-19-15(20(14)26)5-3-7-17(19)22/h2-7,12-13,25H,8-11H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | BNBDEPYHNYVYQM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|